monethmalubay monethmalubay

04-01-2021
Chemistry

contestada

what is solvent ?
PLSS CAN SOME ONE ANSWER?

Respuesta :

megantian423 megantian423

04-01-2021

Answer:

A solvent is a substance that dissolves and turns into a solution.

Explanation:

Answer Link

04-01-2021

having assets in excess of liabilities; able to pay one's debts.

Answer Link

Otras preguntas

ANSWER ASAP PLEASEEEE What famous musician watched the events of 9/11 from a airport runway, then wrote a song about it? Question 7 options: Bon Jovi Paul McCar

What is the preposition in the sentence. We road our bikes along the road.

A farmer has a total of 7705 corn plants. He wants to plant 40 corn plants in each row. He does the following work in long division A.The farmer plants 192 row

Which is an example of a physical change? A. baked bread rising B. metal rusting C. water boiling D. wood burning

At a zoo, 9 monkeys ate 81 bananas in one day. At this rate, how many bananas could 13 monkeys eat in one day? IF YOU KNOW THE ANSWER SAY IT IF U DONT THEN DON

Complete the equation of the line through (1,4) and (2,2). y=

what two numbers' sum=-4 and product=-2

Which human development function is described in the following scenario? Mara is playing with her infant, and she repeats the word "ball" over and over while ho

What is the value of the expression -2a +b when a = -2 and b = 4

what is the exact value of cos(11pi/21)cos(pi/7)-sin(11pi/21)sin(pi/7)?a. -squr3/2b. -1/2c. 1/2d. squr3/2